![2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one (CAS: 3158-91-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0634709.png "2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one chemical structure")
2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one
Catalog No: FT-0634709
CAS No: 3158-91-6
- Chemical Name: 2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one
- Molecular Formula: C13H8ClNO2
- Molecular Weight: 245.66
- InChI Key: ZAGINEPNYIZLLO-UHFFFAOYSA-N
- InChI: InChI=1S/C13H8ClNO2/c14-8-5-6-11-9(7-8)13(16)15-10-3-1-2-4-12(10)17-11/h1-7H,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 242-244ºC |
|---|---|
| CAS: | 3158-91-6 |
| MF: | C13H8ClNO2 |
| Flash_Point: | 147.8ºC |
| Product_Name: | 2-Chloro-10,11-dihydro-11-oxo-dibenzo[b,f][1,4]oxazepine |
| Density: | 1.369 g/cm3 |
| FW: | 245.66100 |
| Bolling_Point: | 320.8ºC at 760 mmHg |
| Melting_Point: | 242-244ºC |
|---|---|
| Refractive_Index: | 1.629 |
| MF: | C13H8ClNO2 |
| Flash_Point: | 147.8ºC |
| LogP: | 3.83600 |
| FW: | 245.66100 |
| Density: | 1.369 g/cm3 |
| PSA: | 38.33000 |
| Bolling_Point: | 320.8ºC at 760 mmHg |
| Exact_Mass: | 245.02400 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-